![2-Azaspiro[4.6]undecan-3-one (CAS: 134617-89-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0683696.png "2-Azaspiro[4.6]undecan-3-one chemical structure")
2-Azaspiro[4.6]undecan-3-one
Catalog No: FT-0683696
CAS No: 134617-89-3
- Chemical Name: 2-Azaspiro[4.6]undecan-3-one
- Molecular Formula: C10H17NO
- Molecular Weight: 167.25
- InChI Key: YXTWCCJCYBPHGQ-UHFFFAOYSA-N
- InChI: InChI=1S/C10H17NO/c12-9-7-10(8-11-9)5-3-1-2-4-6-10/h1-8H2,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 167.24800 |
| Density: | 1.03g/cm3 |
| CAS: | 134617-89-3 |
| Bolling_Point: | 343.3ºC at 760 mmHg |
| Product_Name: | 2-Azaspiro[4.6]undecan-3-one |
| Melting_Point: | N/A |
| Flash_Point: | 202.1ºC |
| MF: | C10H17NO |
| Density: | 1.03g/cm3 |
|---|---|
| LogP: | 2.17570 |
| Flash_Point: | 202.1ºC |
| Refractive_Index: | 1.505 |
| FW: | 167.24800 |
| PSA: | 29.10000 |
| MF: | C10H17NO |
| Bolling_Point: | 343.3ºC at 760 mmHg |
| Vapor_Pressure: | 7.12E-05mmHg at 25°C |
| Exact_Mass: | 167.13100 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2933790090 |
| RIDADR: | NONH for all modes of transport |
Related Products
![N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isoleucine (CAS: 118904-37-3) - Related Chemical Product](/static/img/prod_pic/FT-0689537.png "N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-isoleucine chemical structure")
cis-2,6-DiMethyl-1-(1-oxo-3-propoxy-2-propenyl)-4-(3-phenylpropyl)-Piperazine (2Z)-2-butenedioate
